Latamoxef

Bách khoa toàn thư mở Wikipedia
Buớc tưới chuyển hướng Bước tới tìm kiếm
Latamoxef
Các định danh

-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Latamoxef.svg | tradename = | Drugs.com = Tên thuốc quốc tế | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Intramuscular, intravenous | bioavailability = | protein_bound = 35 to 50% | metabolism = Nil | elimination_half-life = 2 hours | excretion = Mostly Thận, unchanged; also biliary | CAS_number = 64952-97-2 | CAS_number_Ref = | ATC_prefix = J01 | ATC_suffix = DD06 | PubChem = 47499 | DrugBank = DB04570 | DrugBank_Ref =  KhôngN | ChemSpiderID = 43215 | ChemSpiderID_Ref =  Có  | UNII = VUF6C936Z3 | UNII_Ref = Bản mẫu:Fdacite | KEGG = D08109 | KEGG_Ref =  Có  | ChEBI = 599928 | ChEBI_Ref =  KhôngN | ChEMBL = 74632 | ChEMBL_Ref =  Có  | C = 20 | H = 20 | N = 6 | O = 9 | S = 1 | molecular_weight = 520.474 g/mol | SMILES = O=C2N1/C(=C(\CO[C@@H]1[C@]2(OC)NC(=O)C(c3ccc(O)cc3)C(=O)O)CSc4nnnn4C)C(=O)O | StdInChI = 1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12?,18-,20+/m1/s1 | StdInChIKey = JWCSIUVGFCSJCK-CAVRMKNVSA-N | StdInChIKey_Ref =  Có  | StdInChI_Ref =  Có  | verifiedrevid = 408571626 }} Latamoxef (hoặc moxalactam) là một loại kháng sinh oxacephem thường được nhóm với các cephalosporin. Trong các oxacephem như latamoxef, nguyên tử lưu huỳnh của lõi cephalosporin được thay thế bằng một nguyên tử oxy.

Latamoxef có liên quan đến thời gian chảy máu kéo dài, và một số trường hợp rối loạn đông máu, một số trường hợp tử vong, đã được báo cáo trong những năm 1980.[1][2] Latamoxef không còn có sẵn ở Hoa Kỳ. Như với cephalosporin khác với một chuỗi bên methylthiotetrazole, latamoxef gây ra antabuse phản ứng khi trộn với rượu. Ngoài ra, chuỗi bên methylthiotetrazole ức chế car-carboxyl hóa axit glutamic; điều này có thể can thiệp vào các hoạt động của vitamin K

Nó đã được mô tả như là một cephalosporin thế hệ thứ ba.[3]

Tổng hợp[sửa | sửa mã nguồn]

Kháng sinh cephalosporin thế hệ thứ ba thay thế oxa (oxacephalosporin).

Tổng hợp Moxalactam:[4][5][6][7] (trích từ cuốn sách Lednicer 3)

Este benzhydrol của axit 6-Aminopenicillanic (6-APA) được khử trùng bằng S-clo và được xử lý bằng bazơ, trong đó các mảnh sulfenyl clorua trung gian (đến 2). Tiếp theo, sự dịch chuyển với rượu propargyl với sự hiện diện của kẽm clorua chủ yếu là hóa học lập thể được đại diện bởi diastereoisome 3. Chuỗi bên được bảo vệ như phenylacetylamide; liên kết ba được giảm một phần với 5% Pd-CaCO3 (chất xúc tác Lindlar) và sau đó được epoxid hóa với mCPBA để cho 4. Epoxide được mở ở đầu bị cản trở ít nhất với 1-methyl-1 H -tetrazole-5-thiol để đặt chuỗi bên C-3 trong tương lai và cho 5 trung gian. Quá trình oxy hóa Jones sau đó lần lượt là ozonolysis (khử hoạt tính với kẽm-AcOH) và phản ứng với SOCl2pyridine cho halide 6. Giai đoạn bây giờ ướt cho phản ứng Wittig nội phân tử. Sự dịch chuyển với PPh3 và Wittig olefination cho 1-oxacephem 7. Tiếp theo, một chuỗi được thực hiện trao đổi chuỗi bên và giới thiệu nhóm 7-methoxyl tương tự như có trong cephamycin và mang lại cho chúng sự ổn định beta-lactamase được tăng cường. 7 đầu tiên được chuyển đổi thành imino clorua với PCl5 và sau đó thành imino methyl ether (với metanol) và tiếp theo bị thủy phân thành amin tự do (8). Sự hình thành imine với 3,5-di-t-butyl-4-hydroxybenzaldehyd tiếp theo được thực hiện dẫn đến 9. Oxy hóa bằng niken peroxit tạo ra iminoquinone methide 10, trong đó metanol được thêm vào theo nghĩa liên hợp và trong hóa học vô trùng được trình bày theo công thức 11. Imine được trao đổi với thuốc thử T của Girard để cung cấp 12, và chất này được acyl hóa bởi arylmalonate được bảo vệ thích hợp, vì hemiester hemiacid clorua để cung cấp 11. Gỡ rối bằng nhôm clorua và anisole cho moxalactam 14.

Tham khảo[sửa | sửa mã nguồn]

  1. ^ Weitekamp MR, Aber RC (1983). “Prolonged bleeding times and bleeding diathesis associated with moxalactam administration”. JAMA 249 (1): 69–71. PMID 6217353. doi:10.1001/jama.249.1.69. 
  2. ^ Brown RB, Klar J, Lemeshow S, Teres D, Pastides H, Sands M (1986). “Enhanced bleeding with cefoxitin or moxalactam. Statistical analysis within a defined population of 1493 patients”. Arch Intern Med 146 (11): 2159–64. PMID 3778044. doi:10.1001/archinte.146.11.2159. 
  3. ^ Salem RR, McIndoe A, Matkin JA, Lidou AC, Clarke A, Wood CB (tháng 6 năm 1987). “The hematologic effects of latamoxef sodium when used as a prophylaxis during surgical treatment”. Surg Gynecol Obstet 164 (6): 525–9. PMID 3296254. 
  4. ^ M. Narisada, W. Nagata, Đăng ký phát minh {{{country}}} {{{number}}}, "{{{title}}}", trao vào [[{{{gdate}}}]] ; eidem, Bằng sáng chế Hoa Kỳ số 4.138.486 (1977, 1979 both to Shionogi).
  5. ^ Narisada, Masayuki; Yoshida, Tadashi; Onoue, Hiroshi; Ohtani, Mitsuaki; Okada, Tetsuo; Tsuji, Teruji; Kikkawa, Ikuo; Haga, Nobuhiro; Satoh, Hisashi (1979). “Synthetic studies on β-lactam antibiotics. Part 10. Synthesis of 7β-[2-carboxy-2-(4-hydroxyphenyl)acetamido]-7.alpha.-methoxy-3-[[(1-methyl-1H-tetrazol-5-yl)thio]methyl]-1-oxa-1-dethia-3-cephem-4-carboxylic acid disodium salt (6059-S) and its related 1-oxacephems”. Journal of Medicinal Chemistry 22 (7): 757–9. PMID 448673. doi:10.1021/jm00193a001. 
  6. ^ Otsuka, H.; Nagata, W.; Yoshioka, M.; Narisada, M.; Yoshida, T.; Harada, Y.; Yamada, H. (1981). “Discovery and development of moxalactam (6059-S): The chemistry and biology of 1-oxacephems”. Medicinal Research Reviews 1 (3): 217. PMID 6213825. doi:10.1002/med.2610010302. 
  7. ^ Narisada, Masayuki; Onoue, Hiroshi; Nagata, Wataru (1977). “Synthetic Studies on b-Lactam Antibiotics. Part 5. A Synthesis of 7b-Acylamino-3-methyl-1-oxadethia-3-cephem-4-carboxylic Acids”. Heterocycles 7 (2): 839. doi:10.3987/S-1977-02-0839.