Khác biệt giữa bản sửa đổi của “Ketamin”

Bách khoa toàn thư mở Wikipedia
Duyệt lịch sử tương tác
← Thay đổi trướcThay đổi sau →
Nội dung được xóa Nội dung được thêm vào
Trực quanMã wiki
nKhông có tóm lược sửa đổi
Không có tóm lược sửa đổi
Dòng 1: Dòng 1:
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 477168837
| IUPAC_name = (''RS'')-2-(2-Chlorophenyl)-2-(methylamino)cyclohexanone
| image = Ketamine.svg
| width = 150
|image2 = Ketamine.png
| chirality = [[Racemic mixture]]
| drug_name =
<!--Clinical data-->
| Drugs.com = {{drugs.com|CDI|ketamine}}
| licence_US = Ketamine
| pregnancy_AU = B3
| pregnancy_US = C
| legal_AU = S8
| legal_CA = Schedule I
| legal_UK = Class B
| legal_US = Schedule III
| legal_UN = Unscheduled
| routes_of_administration = [[Intravenous therapy|IV]], [[Intramuscular injection|IM]], [[insufflation (medicine)|insufflated]], by mouth, [[Intraosseous infusion|intraosseous]], intranasal, [[topical]]
| addiction_liability = Low–moderate<ref name="NHM-PCP and ketamine">{{cite book |vauthors=Malenka RC, Nestler EJ, Hyman SE |veditors=Sydor A, Brown RY | title = Molecular Neuropharmacology: A Foundation for Clinical Neuroscience | year = 2009 | publisher = McGraw-Hill Medical | location = New York | isbn = 9780071481274 | pages = 374–375 | edition = 2nd | chapter = Chapter 15: Reinforcement and Addictive Disorders | quote= Phencyclidine (PCP or angel dust) and ketamine (also known as special K) are structurally related drugs... their reinforcing properties and risks related to compulsive abuse}}</ref>

<!--Pharmacokinetic data-->
| metabolism = Liver, primarily by CYP3A4<ref>{{Cite journal |last1= Hijazi |first1= Y |last2= Boulieu |first2= R |title= Contribution of CYP3A4, CYP2B6, and CYP2C9 isoforms to N-demethylation of ketamine in human liver microsomes |journal= [[Drug Metabolism and Disposition]] |volume= 30 |issue= 7 |pages= 853–8 |date= July 2002 |pmid= 12065445 |doi= 10.1124/dmd.30.7.853}}</ref>
| elimination_half-life = 2.5–3 hours
| excretion = Kidney (>90%)
| onset = < 5min (IM, IV), < 30min (by mouth)<ref name=Mary2014/>
| duration_of_action = less than one hour<ref name=Mary2014/>

<!--Identifiers-->
| IUPHAR_ligand = 4233
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 6740-88-1
| ATC_prefix = N01
| ATC_suffix = AX03
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 6121
| PubChem = 3821
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01221
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3689
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 690G0D6V8H
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08098
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 742

<!--Chemical data-->
| C=13 | H=16 | Cl=1 | N=1 | O=1
| molecular_weight = 237.725 g/mol
| smiles = CNC1(C2=CC=CC=C2Cl)CCCCC1=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YQEZLKZALYSWHR-UHFFFAOYSA-N
| melting_point = 262
|alt=|caption=|type=|MedlinePlus=|legal_status=|licence_EU=|pregnancy_category=}}
'''Ketamin''' là loại [[chất kích thích]] trong y học sử dụng gây tê cục bộ khi hít hoặc hút ở dạng tinh thể sẽ gây ảo giác nhạy cảm với âm thanh, ánh sáng.
'''Ketamin''' là loại [[chất kích thích]] trong y học sử dụng gây tê cục bộ khi hít hoặc hút ở dạng tinh thể sẽ gây ảo giác nhạy cảm với âm thanh, ánh sáng.


{{Sơ khai hóa học}}
{{Sơ khai hóa học}}
{{thể loại Commons|Ketamin}}
{{thể loại Commons|Ketamine}}


[[Thể loại:Chất kích thích]]
[[Thể loại:Chất kích thích]]

Phiên bản lúc 06:37, ngày 12 tháng 6 năm 2017

Ketamin
Dữ liệu lâm sàng
AHFS/Drugs.comThông tin thuốc cho người dùng
Giấy phép
Danh mục cho thai kỳ
  • AU: B3
  • US: C (Rủi ro không bị loại trừ)
Nguy cơ gây nghiệnLow–moderate[1]
Dược đồ sử dụngIV, IM, insufflated, by mouth, intraosseous, intranasal, topical
Mã ATC
Tình trạng pháp lý
Tình trạng pháp lý
Dữ liệu dược động học
Chuyển hóa dược phẩmLiver, primarily by CYP3A4[2]
Bắt đầu tác dụng< 5min (IM, IV), < 30min (by mouth)[3]
Chu kỳ bán rã sinh học2.5–3 hours
Thời gian hoạt độngless than one hour[3]
Bài tiếtKidney (>90%)
Các định danh
Tên IUPAC
  • (RS)-2-(2-Chlorophenyl)-2-(methylamino)cyclohexanone
Số đăng ký CAS
PubChem CID
IUPHAR/BPS
DrugBank
ChemSpider
Định danh thành phần duy nhất
KEGG
ChEBI
ChEMBL
ECHA InfoCard100.027.095
Dữ liệu hóa lý
Công thức hóa họcC13H16ClNO
Khối lượng phân tử237.725 g/mol
Mẫu 3D (Jmol)
Thủ đối tính hóa họcRacemic mixture
Điểm nóng chảy262 °C (504 °F)
SMILES
  • CNC1(C2=CC=CC=C2Cl)CCCCC1=O
Định danh hóa học quốc tế
  • InChI=1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 ☑Y
  • Key:YQEZLKZALYSWHR-UHFFFAOYSA-N ☑Y
  (kiểm chứng)

Ketamin là loại chất kích thích trong y học sử dụng gây tê cục bộ khi hít hoặc hút ở dạng tinh thể sẽ gây ảo giác nhạy cảm với âm thanh, ánh sáng.

  1. ^ Malenka RC, Nestler EJ, Hyman SE (2009). “Chapter 15: Reinforcement and Addictive Disorders”. Trong Sydor A, Brown RY (biên tập). Molecular Neuropharmacology: A Foundation for Clinical Neuroscience (ấn bản 2). New York: McGraw-Hill Medical. tr. 374–375. ISBN 9780071481274. Phencyclidine (PCP or angel dust) and ketamine (also known as special K) are structurally related drugs... their reinforcing properties and risks related to compulsive abuse
  2. ^ Hijazi, Y; Boulieu, R (tháng 7 năm 2002). “Contribution of CYP3A4, CYP2B6, and CYP2C9 isoforms to N-demethylation of ketamine in human liver microsomes”. Drug Metabolism and Disposition. 30 (7): 853–8. doi:10.1124/dmd.30.7.853. PMID 12065445.
  3. ^ a b Lỗi chú thích: Thẻ <ref> sai; không có nội dung trong thẻ ref có tên Mary2014
Lấy từ “https://vi.wikipedia.org/w/index.php?title=Ketamin&oldid=26655613”