Cefuroxime

Bách khoa toàn thư mở Wikipedia
Buớc tưới chuyển hướng Bước tới tìm kiếm
Cefuroxime
Các định danh
ECHA InfoCard100.054.127

-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Cefuroxime.svg | alt = Skeletal formula of cefuroxime | image2 = Cefuroxime-3D-spacefill.png | alt2 = Ball-and-stick model of the cefuroxime molecule | tradename = Zinacef, Ceftin | MedlinePlus = a601206 | pregnancy_category = B | legal_status = Rx-only | routes_of_administration = Intramuscular, intravenous, oral | bioavailability = 37% on an empty stomach, up to 52% if taken after food | elimination_half-life = 80 minutes | excretion = Urine 66–100% unchanged | CAS_number = 55268-75-2 | CAS_number_Ref = | ATC_prefix = J01 | ATC_suffix = DC02 | ATC_supplemental = S01AA27 QJ51DC02 | PubChem = 5361202 | DrugBank = DB01112 | DrugBank_Ref =  Có  | ChemSpiderID = 4514699 | ChemSpiderID_Ref =  Có  | UNII = O1R9FJ93ED | UNII_Ref = Bản mẫu:Fdacite | KEGG = D00262 | KEGG_Ref =  Có  | ChEMBL = 466 | ChEMBL_Ref =  Có  | C = 16 | H = 16 | N = 4 | O = 8 | S = 1 | SMILES = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)C(=N\OC)\c3occc3)COC(=O)N)C(=O)O | StdInChI = 1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9+/t10-,14-/m1/s1 | StdInChIKey = JFPVXVDWJQMJEE-SWWZKJRFSA-N | StdInChIKey_Ref =  Có  | StdInChI_Ref =  Có  | verifiedrevid = 460025245 }}Cefuroxime là một thuốc kháng sinh cephalosporin thế hệ thứ hai. Nó được phát hiện bởi Glaxo, hiện tại là GlaxoSmithKline, và đưa ra thị trường đầu tiên vào năm 1978 dưới tên thương mại Zinacef. Nó nhận được sự chấp thuận của FDA vào tháng 10 năm 1983.[1]

Tác dụng[sửa | sửa mã nguồn]

Cũng như các cephalosporin khác, nó là nhạy cảm với beta-lactamase, mặc dù yếu hơn. Do đó, nó có tác dụng chống lại Haemophilus influenzae, Neisseria gonorrhoeae, và bệnh Lyme. Không giống như hầu hết các cephalosporin thế hệ thứ hai khác, cefuroxime có thể đi qua hàng rào máu não.

Một nghiên cứu hệ thống cho thấy bằng chứng cao rằng nhỏ mắt với cefuroxime sau khi phẫu thuật đục thủy tinh thể sẽ làm giảm tình trạng endophthalmitis sau phẫu thuật.[2]

Tác dụng phụ[sửa | sửa mã nguồn]

Cefuroxime nói chung thường hấp thu tốt và ít tác dụng phụ. Nếu uống sau ăn, kháng sinh này được hấp thụ tốt hơn và giảm khả năng gây ra tác dụng phụ như tiêu chảy, buồn nôn, nôn mửa, nhức đầu/đau nửa đầu, chóng mặt và đau bụng so với hầu hết thuốc kháng sinh nhóm này.[cần dẫn nguồn]

Mặc dù có khoảng 10% nguy cơ dị ứng chéo giữa cephalosporin và penicillin, những đánh giá gần đây đã cho thấy không có hiện tượng tăng nguy cơ phản ứng dị ứng chéo của cefuroxime và một số thuốc thế hệ thứ hai hay các nhóm cephalosporin thế hệ sau.[3] GSK had continued marketing a pediatric oral suspension as Ceftin; however, this presentation was discontinued as of June 24, 2017.[4]

Tên thương mại[sửa | sửa mã nguồn]

Ở US, nó có tên Zinacef  phân phối bởi Covis Pharmaceuticals.[3] 

Ở Bangladesh, nó có tên Kilbac phân phối bởi Incepta và Xorimax phân phối bởi Sandoz. Ở Ấn độ, nó có tên Ceftum dưới dạng vỉ  và Supacef dưới dạng tiêm phân phối bởi GSK.[5] Ở Ba Lan, nó có tên Zamur phân phối bởi Mepha, chi nhánh của Tập đoàn Dược phẩm Teva.[6] 

Tham khảo[sửa | sửa mã nguồn]