Xem mã nguồn của Tryptophan

{{chembox
| Verifiedfields = changed
| verifiedrevid = 477866188
| Name = <small>L</small>-Tryptophan
| ImageFile = 
| ImageSize = 150px
| ImageName =  L-Tryptophan - L-Tryptophan.svg
| ImageFile2 = 
| ImageSize2 = 150px
| ImageName2 = L-tryptophan-3D-balls.png
| IUPACName = Tryptophan or (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid
| OtherNames = 2-Amino-3-(1''H''-indol-3-yl)propanoic acid
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6066
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8DUH1N11BX
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 54976
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00020
| InChI = 1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
| InChIKey = QIVBCDIJIAJPQS-VIFPVBQEBP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QIVBCDIJIAJPQS-VIFPVBQESA-N
| CASNo = 73-22-3
|    CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 6305
| IUPHAR_ligand = 717
| ATCCode_prefix = N06
| ATCCode_suffix = AX02
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00150
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 27897
| SMILES = c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)N
}}
| Section2 = {{Chembox Properties
| C=11 | H=12 | N=2 | O=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = Hòa tan được: 0.23 g/L ở 0 °C,<br>
11.4 g/L ở 25 °C,<br>
17.1 g/L ở 50 °C,<br>
27.95 g/L ở 75 °C
| SolubleOther = Tan trong alcohol, không tan trong [[chloroform]].
| pKa = 2.38 (carboxyl), 9.39 (amino)
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}}
'''Tryptophan''' (IUPAC-IUBMB viết tắt: '''Trp''' hoặc '''W;''' [[IUPAC]] viết tắt: L-Trp hoặc D-Trp, bán dùng trong y tế như '''Tryptan) '''là một amino acid có công thức là C<sub>11</sub>H<sub>12</sub>N<sub>2</sub>O<sub>2</sub>, không có mùi và là một [[amino acid]] không thay thế được. Tryptophan chứa [[dị vòng]] indol. Trong hệ tiêu hoá tryptophan được tiêu hoá thành hai dị vòng là [[indol]] và [[xcatol]].

== Phân lập ==
Sự phân lập của tryptophan lần đầu tiên được báo cáo bởi [[Frederick Hopkins]] vào năm 1901 <ref name="pmid16992614">{{chú thích tạp chí | author = Hopkins FG, Cole SW | title = A contribution to the chemistry of proteids: Part I. A preliminary study of a hitherto undescribed product of tryptic digestion | journal = J. Physiol. (Lond.) | volume = 27 | issue = 4–5 | pages = 418–28 | year = 1901 | pmid = 16992614 | pmc = 1540554 | doi =  }}</ref> thông qua quá trình [[thủy phân]] của [[casein]]. Từ 600 [[gram]] casein thô có được 4-8 gram tryptophan <ref name="Cox_1943">{{OrgSyn |  author = Cox GJ, King H | title = L-Tryptophane | collvol = 2 | collvolpages = 612–616 | year = 1943 | prep = CV2P0612}}</ref>

==Sinh tổng hợp và sản xuất công nghiệp==
Thực vật và [[vi sinh vật]] thường tổng hợp tryptophan từ [[acid shikimic]] hoặc [[anthranilate]].<ref name="pmid7640526">{{chú thích tạp chí | author = Radwanski ER, Last RL | title = Tryptophan biosynthesis and metabolism: biochemical and molecular genetics | url = https://archive.org/details/sim_plant-cell_1995-07_7_7/page/921 | journal = Plant Cell | volume = 7 | issue = 7 | pages = 921–34 | year = 1995 | pmid = 7640526 | pmc = 160888 | doi = 10.1105/tpc.7.7.921 }}</ref> Sau đó [[ngưng tụ]] với [[phosphoribosylpyrophosphate]] (PRPP), tạo ra [[pyrophosphate]] như một sản phẩm phụ. Sau khi mở vòng của phân nưa [[ribose]] và sau khử decarboxylation, sẽ sản xuất ra indole-3-glycerinephosphate, rồi chuyển thành indol. Sau cùng, synthase tryptophan xúc tác sự hình thành của tryptophan từ indole và các amino acid [[serine]].

:[[Hình:Tryptophan biosynthesis (en).svg|755px]]

Sản xuất công nghiệp của tryptophan cũng là sinh tổng hợp và được dựa trên quá trình lên men của [[serine]] và indole bằng cách sử dụng các vi khuẩn hoang dã hoặc biến đổi gen như B. amyloliquefaciens, B. subtilis, C. glutamicum hoặc [[Escherichia coli|E. coli]]. Các chủng mang đột biến hoặc ngăn chặn sự tái hấp thu các amino acid thơm. Việc chuyển đổi được xúc tác bởi các enzyme synthase tryptophan.<ref name="pmid12523387">{{chú thích tạp chí | author = Ikeda M | title = Amino acid production processes | journal = Adv. Biochem. Eng. Biotechnol. | volume = 79 | issue =  | pages = 1–35 | year = 2002 | pmid = 12523387 | doi = 10.1007/3-540-45989-8_1 | isbn = 978-3-540-43383-5 | series = Advances in Biochemical Engineering/Biotechnology }}</ref><ref name="pmid22138494">{{chú thích tạp chí | author = Becker J, Wittmann C | title = Bio-based production of chemicals, materials and fuels -Corynebacterium glutamicum as versatile cell factory | journal = Curr. Opin. Biotechnol. | volume = 23 | issue = 4 | pages = 631–40 | year = 2012 | pmid = 22138494 | doi = 10.1016/j.copbio.2011.11.012 }}</ref><ref name="pmid18725290">{{chú thích tạp chí | author = Conrado RJ, Varner JD, DeLisa MP | title = Engineering the spatial organization of metabolic enzymes: mimicking nature's synergy | journal = Curr. Opin. Biotechnol. | volume = 19 | issue = 5 | pages = 492–9 | year = 2008 | pmid = 18725290 | doi = 10.1016/j.copbio.2008.07.006 }}</ref>

== Nguồn thực phẩm ==
Tryptophan là một thành phần có mặt trong hầu hết các loại thực phẩm có protein. Nó đặc biệt phong phú trong [[sôcôla]], [[yến mạch]], [[chà là]] khô, [[sữa]], [[sữa chua]], [[pho mát]], [[thịt đỏ]], [[trứng (thực phẩm)|trứng]], [[cá]], [[gia cầm]], [[mè]], [[đậu xanh]], [[hạt hướng dương]], [[hạt bí đỏ]], [[tảo spirulina]], [[chuối]], và [[đậu phộng]].<ref name= Tryptophan_background >{{Chú thích web |url=http://www.vitamins-supplements.org/amino-acids/tryptophan.php |ngày truy cập=2014-06-09 |tựa đề=Tryptophan background |archive-date=2011-06-21 |archive-url=https://web.archive.org/web/20110621113620/http://www.vitamins-supplements.org/amino-acids/tryptophan.php |url-status=dead }}</ref> Người ta tin rằng  [[gà tây]] có một hàm lượng cao tryptophan, lượng tryptophan trong [[thịt gà tây]] điển hình plp cho hầu hết các gia cầm.<ref name = "USDA">{{chú thích web|title= USDA National Nutrient Database for Standard Reference, Release 22 |publisher= United States Department of Agriculture | author = Joanne Holden, Nutrient Data Laboratory, Agricultural Research Service | url=http://www.ars.usda.gov/ba/bhnrc/ndl | access-date = ngày 29 tháng 11 năm 2009}}</ref>  Ngoài ra còn có một số quan điểm cho rằng protein thực vật thiếu tryptophan; trên thực tế, tryptophan có mặt với hàm lượng đáng kể ở hầu hết các protein thực vật, thậm chí một số thực vật còn phong phú tryptophan.

==Tham khảo==
{{tham khảo|30em}}

[[Thể loại:Chất dinh dưỡng bổ sung]]
[[Thể loại:Amino acid thiết yếu]]
[[Thể loại:Amino acid sinh đường]]
[[Thể loại:Amino acid sinh ceton]]
[[Thể loại:Amino acid sinh protein]]