Xem mã nguồn của Anandamide

{{Chembox
| Verifiedfields = changed
| verifiedrevid = 464364547
| ImageFile1 = Anandamide_skeletal.svg
| ImageFile2 = 
| PIN = (5''Z'',8''Z'',11''Z'',14''Z'')-''N''-(2-hydroxyethyl)icosa-5,8,11,14-tetraenamide
| OtherNames = ''N''-arachidonoylethanolamine<!-- amine is actually correct here, despite pubchem (see talk page) --><br>arachidonoylethanolamide
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445241
| InChI = 1/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15-
| InChIKey = LGEQQWMQCRIYKG-DOFZRALJBA
| SMILES1 = CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCO
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 15848
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LGEQQWMQCRIYKG-DOFZRALJSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 94421-68-8
| PubChem = 5281969
| IUPHAR_ligand = 2364
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UR5G69TJKH
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 2700
| SMILES = O=C(NCCO)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC
| MeSHName = Anandamide
 }}
|Section2={{Chembox Properties
| Formula = C<sub>22</sub>H<sub>37</sub>NO<sub>2</sub>
| MolarMass = 347.53 g/mol
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
 }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt =
 }}
}}
'''Anandamide''' (còn được gọi là '''''N'' -arachidonoylethanolamine''' hoặc '''AEA'''), là một [[Axit béo|chất]] [[Chất dẫn truyền thần kinh|dẫn truyền thần kinh]] [[axit béo]] có nguồn gốc từ quá trình chuyển hóa không oxy hóa của axit eicosatetraenoic ([[axit arachidonic]]), một loại axit béo đa chức chưa bão hòa ω-6 thiết yếu. Tên của nó được lấy từ [[tiếng Phạn]] ''ananda'', có nghĩa là "niềm vui, [[hạnh phúc]]", và [[amid]]e.<ref name="pmid1470919">{{Chú thích tạp chí|last=Devane|first=W.|last2=Hanus|first2=L|last3=Breuer|first3=A|last4=Pertwee|first4=R.|last5=Stevenson|first5=L.|last6=Griffin|first6=G|last7=Gibson|first7=D|last8=Mandelbaum|first8=A|last9=Etinger|first9=A|date=ngày 18 tháng 12 năm 1992|title=Isolation and structure of a brain constituent that binds to the cannabinoid receptor|journal=Science|volume=258|issue=5090|pages=1946–1949|bibcode=1992Sci...258.1946D|doi=10.1126/science.1470919|pmid=1470919}}</ref><ref name="isbn0-12-551460-3">{{Chú thích sách|title=Cannabinoid receptors|url=https://archive.org/details/cannabinoidrecep0000unse|vauthors=Mechoulam R, Fride E|publisher=Academic Press|year=1995|isbn=978-0-12-551460-6|editor-last=Pertwee RG|location=Boston|pages=[https://archive.org/details/cannabinoidrecep0000unse/page/233 233]–258|chapter=The unpaved road to the endogenous brain cannabinoid ligands, the anandamides}}</ref> Nó được tổng hợp từ ''N'' -arachidonoyl phosphatidylethanolamine bằng nhiều con đường.<ref name="wang2009">{{Chú thích tạp chí|last=Wang|first=J.|last2=Ueda|first2=N.|year=2009|title=Biology of endocannabinoid synthesis system|journal=Prostaglandins & Other Lipid Mediators|volume=89|issue=3–4|pages=112–119|doi=10.1016/j.prostaglandins.2008.12.002|pmid=19126434}}</ref> Chất này bị hạ chức chủ yếu bởi enzyme axit béo amide hydrolase (FAAH), chất chuyển đổi anandamide thành ethanolamine và axit arachidonic. Do đó, các chất ức chế FAAH dẫn đến nồng độ anandamide tăng cao và đang được nghiên cứu để sử dụng trong điều trị.<ref>{{Chú thích sách|title=The endocannabinoid system as a target for novel anxiolytic and antidepressant drugs|last=Gaetani|first=Silvana|last2=Dipasquale|first2=Pasqua|last3=Romano|first3=Adele|last4=Righetti|first4=Laura|last5=Cassano|first5=Tommaso|last6=Piomelli|first6=Daniele|last7=Cuomo|first7=Vincenzo|date=2009|isbn=9780123748935|series=International Review of Neurobiology|volume=85|pages=57–72|doi=10.1016/S0074-7742(09)85005-8|pmid=19607961}}</ref><ref>{{Chú thích tạp chí|last=Hwang|first=Jeannie|last2=Adamson|first2=Crista|last3=Butler|first3=David|last4=Janero|first4=David R.|last5=Makriyannis|first5=Alexandros|author-link5=Alexandros Makriyannis|last6=Bahr|first6=Ben A.|date=April 2010|title=Enhancement of endocannabinoid signaling by fatty acid amide hydrolase inhibition: A neuroprotective therapeutic modality|journal=Life Sciences|volume=86|issue=15–16|pages=615–623|doi=10.1016/j.lfs.2009.06.003|pmc=2848893|pmid=19527737}}</ref>

== Chức năng sinh lý ==
Anandamide được Raphael Mechoulam và các thành viên phòng thí nghiệm của ông WA Devane và Lumír Hanuš mô tả lần đầu tiên (và được đặt tên) vào năm 1992 <ref name="pmid1470919"/>

Tác dụng của Anandamide có thể xảy ra ở cả [[hệ thần kinh trung ương]] hoặc ngoại biên. Những tác dụng riêng biệt này được trung gian chủ yếu bởi [[Thụ thể cannabinoid|các thụ thể]] CB <sub>1</sub> [[Thụ thể cannabinoid|cannabinoid]] trong hệ thống thần kinh trung ương và các thụ thể CB <sub>2</sub> cannabinoid ở ngoại biên.<ref name="pmid16968947">{{Chú thích tạp chí|vauthors=Pacher P, Batkai S, Kunos G|year=2006|title=The Endocannabinoid System as an Emerging Target of Pharmacotherapy|journal=Pharmacol. Rev.|volume=58|issue=3|pages=389–462|doi=10.1124/pr.58.3.2|pmc=2241751|pmid=16968947}}</ref> Loại thứ hai chủ yếu liên quan đến các chức năng của [[Hệ miễn dịch|hệ thống miễn dịch]]. Các thụ thể Cannabinoid ban đầu được phát hiện là nhạy cảm với Δ <sup>9</sup> - [[tetrahydrocannabinol]] (Δ <sup>9</sup> -THC, thường được gọi là THC), là cannabinoid chủ yếu được tìm thấy trong [[Cần sa (chất kích thích)|cần sa]]. Việc phát hiện ra anandamide xuất phát từ nghiên cứu về CB <sub>1</sub> và CB <sub>2</sub>, vì không thể tránh khỏi việc một hóa chất tự nhiên (nội sinh) sẽ được tìm thấy ảnh hưởng đến các thụ thể này.

Anandamide đã được chứng minh là làm suy giảm trí nhớ làm việc ở chuột.<ref>{{Chú thích tạp chí|vauthors=Mallet PE, Beninger RJ|year=1996|title=The endogenous cannabinoid receptor agonist anandamide impairs memory in rats|url=http://www.behaviouralpharm.com/pt/re/bpharm/abstract.00008877-199605000-00008.htm|journal=Behavioural Pharmacology|volume=7|issue=3|pages=276–284|doi=10.1097/00008877-199605000-00008}}</ref> Các nghiên cứu đang được tiến hành để khám phá vai trò của anandamide trong hành vi của con người, chẳng hạn như thói quen ăn, ngủ, và giảm đau.

==Tham khảo==
{{Tham khảo|30em}}

[[Thể loại:Alcohol bậc một]]
[[Thể loại:Phân tử sinh học]]
[[Thể loại:Chất dẫn truyền thần kinh]]