Natri orthophenyl phenol

Bách khoa toàn thư mở Wikipedia
Bước tới: menu, tìm kiếm
Natri orthophenyl phenol
Sodium orthophenyl phenol.svg
Danh pháp IUPAC Natri [1,1'-biphenyl]-2-olat
Tên khác Muối natri của (1,1'-Bip​henyl)-2-​ol; 2-hiđroxi​điphenyl ​natri; o-Phenylp​henol natri; Natri o-​phenylphe​nol; Natri 2-phenylphenolat; Natri o-phenylphenat
Nhận dạng
Số CAS 132-27-4
PubChem 23675735
Ảnh Jmol-3D ảnh
InChI InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1
Thuộc tính
Các nguy hiểm

Natri orthophenyl phenolhợp chất hóa học dùng làm chất khử trùng. Nó là muối natri của 2-phenylphenol.

Là một chất phụ gia thực phẩm, nó có số E là E232.[1]

Chú thích[sửa | sửa mã nguồn]