Xem mã nguồn của Lactose

{{short description|Carbohydrate}}{{Mở rộng ngôn ngữ|name=Lactose|langcode=en}}{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477497006
| Name = Lactose
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Beta-D-Lactose.svg
| ImageSize = 200px
| IUPACName = β-<small>D</small>-Galactopyranosyl-(1→4)-<small>D</small>-glucose
| SystematicName = (2''R'',3''R'',4''S'',5''R'',6''S'')-2-(Hydroxymethyl)-6-<nowiki/>{[(2''R'',3''S'',4''R'',5''R'',6''R'')-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol
| OtherNames = Đường sữa<br />Lactobiose<br />4-''O''-β-<small>D</small>-Galactopyranosyl-<small>D</small>-glucose
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5904
| InChI = 1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1
| InChIKey = GUBGYTABKSRVRQ-DCSYEGIMBP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GUBGYTABKSRVRQ-DCSYEGIMSA-N
| CASNo = 63-42-3
| CASNo_Ref = {{cascite|correct|CAS}}
| EC_number = 200-559-2
| KEGG = C01970
| PubChem = 6134
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 417016
| Gmelin = 342369
| Beilstein = 90841
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3SY5LH9PMK
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 36218
| SMILES = C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O
}}
|Section2={{Chembox Properties
| C=12 | H=22 | O=11
| Appearance = Chất rắn màu trắng
| Density = 1,525{{nbsp}}g/cm<sup>3</sup>
| MeltingPt = 252&nbsp;°C ([[Khan (hóa học)|khan]])<ref name="DoC">{{chú thích sách | author=Peter M. Collins | title=Dictionary of Carbohydrates | edition=2nd | year=2006 | publisher=Chapman & Hall/CRC | location=Boca Raton | isbn=978-0-8493-3829-8 | page=677}}</ref> <br /> 202 °C (monohydrate)<ref name="DoC"/>
| MeltingPt_ref =
| Solubility = 195{{nbsp}}g/L<ref name=PubChem>{{chú thích web | url=https://pubchem.ncbi.nlm.nih.gov/compound/440995#section=Experimental-Properties | title=D-Lactose}}</ref><ref>The solubility of lactose in water is 189.049&nbsp;g at 25&nbsp;°C, 251.484&nbsp;g at 40&nbsp;°C and 372.149&nbsp;g at 60&nbsp;°C per kg solution. Its solubility in [[ethanol]] is 0.111&nbsp;g at 40&nbsp;°C and 0.270&nbsp;g at 60&nbsp;°C per kg solution.{{citation | year = 2001 | last1 = Machado | first1 = José J. B. | first2 = João A. | last2 = Coutinho | first3 = Eugénia A. | last3 = Macedo | title = Solid–liquid equilibrium of α-lactose in ethanol/water | url = http://path.web.ua.pt/file/FPE%20(2000)%20173%20121.pdf | journal = Fluid Phase Equilibria | volume = 173 | issue = 1 | pages = 121–34 | doi = 10.1016/S0378-3812(00)00388-5}}.
ds</ref>
| SpecRotation = +55,4° (khan)<br />+52,3° (monohydrate)
  }}
|Section4={{Chembox Thermochemistry| DeltaHc = 5652{{nbsp}}kJ/mol, 1351{{nbsp}}kcal/mol, 16,5{{nbsp}}kJ/g, 3,94{{nbsp}}kcal/g}}
|Section7={{Chembox Hazards
| FlashPtC = 357.8
| FlashPt_ref = <ref name=Ald>[http://www.sigmaaldrich.com/catalog/product/sial/17814?lang=en&region=US Sigma Aldrich]</ref>
| AutoignitionPtC =
| NFPA-H = 0
| NFPA-F = 0
| NFPA-R = 0
  }}
}}

'''Lactose''' (còn được gọi là '''đường sữa''') là một [[disaccharide]] gồm [[galactose]] và [[glucose]] với [[công thức hóa học]] C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>. Loại đường này được chủ yếu tìm thấy trong [[sữa]], chiếm khoảng 2–8% về khối lượng. Cái tên có nguồn gốc từ [[tiếng Latinh]] ''lact'' (gen.&nbsp;{{lang|la|lactis}}), có nghĩa là ''sữa'', cộng thêm đuôi ''[[-ose]]'' dùng để đặt tên đường.<ref>{{chú thích web|last=McCreary |first=Jeremy |date=ngày 30 tháng 10 năm 2004 |url=https://www.neonics.co.th/sweetness/lactose.html |title= Lactose in water |publisher= Lactose measurement with Digital refractometer |access-date = ngày 7 tháng 11 năm 2006}}</ref> Đây là một chất rắn màu trắng, [[Độ hòa tan|tan trong nước]], không hút ẩm với vị ngọt nhẹ. Nó được sử dụng trong ngành công nghiệp thực phẩm.

== Cấu trúc và phản ứng ==
Lactose là một [[disaccharide]] gồm [[galactose]] và [[glucose]] được liên kết với nhau thông qua [[liên kết glycosidic]] β-1→4. Glucose có thể ở dạng α-[[pyranose]] hoặc dạng β-pyranose, trong khi galactose chỉ có thể ở dạng β-pyranose. Người ta có thể sử dụng thử nghiệm (''test'') Wöhlk<ref>{{chú thích tạp chí |last1=Ruppersberg |first1=Klaus |last2=Blankenburg |first2=Janet |date=2018 |title=150 Years Alfred Wöhlk |url=http://www.chemistryviews.org/details/education/10821368/150_Years_Alfred_Wohlk.html |journal=ChemViews |doi=10.1002/chemv.201800002}}</ref> và Fearon<ref>{{chú thích tạp chí |last=Fearon |first=W. R. |date=1942 |title=The detection of lactose and maltose by means of methylamine |url=http://xlink.rsc.org/?DOI=an9426700130 |journal=The Analyst |language=en |volume=67 |issue=793 |page=130 |doi=10.1039/an9426700130 |issn=0003-2654}}</ref> để phân tích hàm lượng lactose trong các sản phẩm khác nhau từ sữa như sữa nguyên chất, [[Hội chứng không dung nạp lactose|sữa không chứa lactose]], [[sữa chua]], [[buttermilk]], [[kefir]],...<ref>{{chú thích tạp chí |last1=Ruppersberg |first1=Klaus |last2=Herzog |first2=Stefanie |last3=Kussler |first3=Manfred W. |last4=Parchmann |first4=Ilka |date=2019-10-17 |title=How to visualize the different lactose content of dairy products by Fearon's test and Woehlk test in classroom experiments and a new approach to the mechanisms and formulae of the mysterious red dyes |journal=[[Chemistry Teacher International]] |volume=2 |issue=2 |doi=10.1515/cti-2019-0008 |issn=2569-3263 |s2cid=208714341 |doi-access=free}}</ref>

== Độ tan ==
Lactose có độ tan là 1/4,63, tức là 0,216 g lactose tan hoàn toàn trong 1 ml [[nước]].

Độ tan của lactose trong nước là 18,9049 ở 25&nbsp;°C, 25,1484 ở 40&nbsp;°C và 37,2149 ở 60&nbsp;°C trong 100 g dung dịch. Độ tan của lactose trong [[ethanol]] là 0,0111 g ở 40&nbsp;°C và 0,0270 ở 60&nbsp;°C trong 100 g dung dịch.{{sfn|1}}

== Sự trao đổi chất ==
Động vật có vú nuôi con bằng sữa. Để có thể tiêu hóa lactose, cần có một [[enzym]] gọi là [[lactase]], và enzym này tách phân tử thành hai đơn vị [[monosaccharide]] của nó là [[glucose]] và [[galactose]].

== Tham khảo ==
{{tham khảo}}

* Machado, José J.B.; João A. Coutinho, Eugénia A. Macedo (2000). "[http://path.web.ua.pt/file/FPE (2000) 173 121.pdf Solid-liquid equỉlibium of a lactose in ethanol/water]{{Liên kết hỏng|date = ngày 7 tháng 5 năm 2021 |bot=InternetArchiveBot }}" (PDF).  Fluid Phase Equilibria. Truy cập 2007-12-05.

{{Carbohydrates}}
{{Sơ khai hóa học}}

[[Thể loại:Disaccharide]]
[[Thể loại:Carbohydrat]]
[[Thể loại:Tá dược]]
[[Thể loại:Chất ngọt]]
[[Thể loại:Disacarit]]