Tesetaxel

Bách khoa toàn thư mở Wikipedia
Buớc tưới chuyển hướng Bước tới tìm kiếm
Tesetaxel
Các định danh

-10-[(dimethylamino)methyl]-4-hydroxy-7,11b,14,14-tetramethyl-2a,2b,3,4,5,6,8a,11a,11b,12,13,13a-dodecahydro-2H-4,8-methano[1,3]dioxolo[3,4]cyclodeca[1,2-d][1]benzoxet-3-yl benzoate

| image = Tesetaxel.png | tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number = 333754-36-2 | CAS_number_Ref = | ATC_prefix = none | ATC_suffix = | PubChem = 6918574 | DrugBank = | DrugBank_Ref =  Có  | ChemSpiderID = 5293771

| ChemSpiderID_Ref =  KhôngN | UNII = UG97LO5M8Y | UNII_Ref = Bản mẫu:Fdacite | C = 46 | F = 1 | H = 60 | N = 3 | O = 13 | molecular_weight = 881.98 g/mol | SMILES = CC1=C2[C@@H]3[C@H]([C@@]4(CC[C@@H]5[C@]([C@H]4[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C6=C(C=CC=N6)F)NC(=O)OC(C)(C)C)O)O)OC(=O)C7=CC=CC=C7)(CO5)OC(=O)C)C)O[C@@H](O3)CN(C)C | StdInChI = 1S/C46H60FN3O13/c1-24-28(58-40(54)34(52)33(32-27(47)17-14-20-48-32)49-41(55)63-42(3,4)5)21-46(56)38(61-39(53)26-15-12-11-13-16-26)36-44(8,19-18-29-45(36,23-57-29)62-25(2)51)37-35(31(24)43(46,6)7)59-30(60-37)22-50(9)10/h11-17,20,28-30,33-38,52,56H,18-19,21-23H2,1-10H3,(H,49,55)/t28-,29+,30+,33-,34+,35+,36-,37+,38-,44+,45-,46+/m0/s1 | StdInChIKey = MODVSQKJJIBWPZ-VLLPJHQWSA-N | StdInChIKey_Ref =  KhôngN | StdInChI_Ref =  KhôngN | verifiedrevid = 448210005 }} Tesetaxel là một taxane dùng đường uống đang được điều tra như một tác nhân hóa trị liệu cho các loại ung thư khác nhau, bao gồm ung thư vú,[1] ung thư dạ dày,[2] ung thư đại trực tràng,[3] và các khối u rắn khác.[4] Nó khác với các thành viên khác của nhóm taxane (ví dụ paclitaxel hoặc docetaxel) ở chỗ nó được dùng bằng đường uống, không tiêm tĩnh mạch.[5]

Tham khảo[sửa | sửa mã nguồn]

  1. ^ Bản mẫu:ClinicalTrialsGov
  2. ^ Evans, T.; Dobrila, R.; Berardi, R.; Sumpter, K.A.; Wall, L.R.; Oyama, R. (tháng 6 năm 2006). “A phase II study of DJ-927 as second-line therapy in patients (pts) with advanced gastric cancer (GC) who have failed a 5-FU non taxane based regimen”. Journal of Clinical Oncology. 
  3. ^ Bản mẫu:ClinicalTrialsGov
  4. ^ Bản mẫu:ClinicalTrialsGov
  5. ^ Shionoya, Motoko; Jimbo, Takeshi; Kitagawa, Mayumi; Soga, Tsunehiko; Tohgo, Akiko (2003). “DJ-927, a novel oral taxane, overcomes P-glycoprotein-mediated multidrug resistance in vitro and in vivo”. Cancer Science 94 (5): 459–466. doi:10.1111/j.1349-7006.2003.tb01465.x.